C11H10O — CID 575764
tricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-one (PubChem CID 575764) has the molecular formula C11H10O and a molecular weight of 158.20 g/mol. Its IUPAC name is tricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-one.
| Compound Name | tricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 575764 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | tricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-one |
| SMILES | O=C1CC2CC1c1ccccc12 |
| InChI | InChI=1S/C11H10O/c12-11-6-7-5-10(11)9-4-2-1-3-8(7)9/h1-4,7,10H,5-6H2 |
| InChIKey | MMDLBADSUSAPKF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |