C16H12O — CID 98115763
(1S,9S)-tetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-8-one (PubChem CID 98115763) has the molecular formula C16H12O and a molecular weight of 220.27 g/mol. Its IUPAC name is (1S,9S)-tetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-8-one.
| Compound Name | (1S,9S)-tetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-8-one |
|---|---|
| PubChem CID | 98115763 |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (1S,9S)-tetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-8-one |
| SMILES | O=C1c2ccccc2[C@H]2C[C@H]1c1ccccc12 |
| InChI | InChI=1S/C16H12O/c17-16-13-8-4-3-7-12(13)14-9-15(16)11-6-2-1-5-10(11)14/h1-8,14-15H,9H2/t14-,15-/m0/s1 |
| InChIKey | GQGHDCRDNRFAJQ-GJZGRUSLSA-N |
| XLogP | 3.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |