C11H8O — CID 86001889
1-methylidene-1a,6a-dihydrocyclopropa[a]inden-6-one (PubChem CID 86001889) has the molecular formula C11H8O and a molecular weight of 156.18 g/mol. Its IUPAC name is 1-methylidene-1a,6a-dihydrocyclopropa[a]inden-6-one.
| Compound Name | 1-methylidene-1a,6a-dihydrocyclopropa[a]inden-6-one |
|---|---|
| PubChem CID | 86001889 |
| Molecular Formula | C11H8O |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 1-methylidene-1a,6a-dihydrocyclopropa[a]inden-6-one |
| SMILES | C=C1C2C(=O)c3ccccc3C12 |
| InChI | InChI=1S/C11H8O/c1-6-9-7-4-2-3-5-8(7)11(12)10(6)9/h2-5,9-10H,1H2 |
| InChIKey | BJCJDSOULRFUOM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|