C11H7ClF3NO2 — CID 14638800
N-(2-chloro-3-oxo-1,2-dihydroinden-1-yl)-2,2,2-trifluoroacetamide (PubChem CID 14638800) has the molecular formula C11H7ClF3NO2 and a molecular weight of 277.63 g/mol. Its IUPAC name is N-(2-chloro-3-oxo-1,2-dihydroinden-1-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2-chloro-3-oxo-1,2-dihydroinden-1-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 14638800 |
| Molecular Formula | C11H7ClF3NO2 |
| Molecular Weight | 277.63 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | N-(2-chloro-3-oxo-1,2-dihydroinden-1-yl)-2,2,2-trifluoroacetamide |
| SMILES | O=C1c2ccccc2C(NC(=O)C(F)(F)F)C1Cl |
| InChI | InChI=1S/C11H7ClF3NO2/c12-7-8(16-10(18)11(13,14)15)5-3-1-2-4-6(5)9(7)17/h1-4,7-8H,(H,16,18) |
| InChIKey | LMEYTTZHOCZTEC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.63 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|