C10H9ClO — CID 14291532
3-chloro-2-methyl-2,3-dihydroinden-1-one (PubChem CID 14291532) has the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. Its IUPAC name is 3-chloro-2-methyl-2,3-dihydroinden-1-one.
| Compound Name | 3-chloro-2-methyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 14291532 |
| Molecular Formula | C10H9ClO |
| Molecular Weight | 180.63 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 3-chloro-2-methyl-2,3-dihydroinden-1-one |
| SMILES | CC1C(=O)c2ccccc2C1Cl |
| InChI | InChI=1S/C10H9ClO/c1-6-9(11)7-4-2-3-5-8(7)10(6)12/h2-6,9H,1H3 |
| InChIKey | QPSWSLXTSDUUNT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.63 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|