C12H12O2 — CID 123539501
3,4-dimethyl-3,4-dihydronaphthalene-1,2-dione (PubChem CID 123539501) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3,4-dimethyl-3,4-dihydronaphthalene-1,2-dione.
| Compound Name | 3,4-dimethyl-3,4-dihydronaphthalene-1,2-dione |
|---|---|
| PubChem CID | 123539501 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 3,4-dimethyl-3,4-dihydronaphthalene-1,2-dione |
| SMILES | CC1C(=O)C(=O)c2ccccc2C1C |
| InChI | InChI=1S/C12H12O2/c1-7-8(2)11(13)12(14)10-6-4-3-5-9(7)10/h3-8H,1-2H3 |
| InChIKey | QJCQSRMQMQXUKL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|