C15H16O3 — CID 163048127
(2S,3aS,9bR)-2,3,3-trimethyl-3a,9b-dihydro-2H-benzo[g][1]benzofuran-4,5-dione (PubChem CID 163048127) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2S,3aS,9bR)-2,3,3-trimethyl-3a,9b-dihydro-2H-benzo[g][1]benzofuran-4,5-dione.
| Compound Name | (2S,3aS,9bR)-2,3,3-trimethyl-3a,9b-dihydro-2H-benzo[g][1]benzofuran-4,5-dione |
|---|---|
| PubChem CID | 163048127 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (2S,3aS,9bR)-2,3,3-trimethyl-3a,9b-dihydro-2H-benzo[g][1]benzofuran-4,5-dione |
| SMILES | C[C@@H]1O[C@H]2c3ccccc3C(=O)C(=O)[C@H]2C1(C)C |
| InChI | InChI=1S/C15H16O3/c1-8-15(2,3)11-13(17)12(16)9-6-4-5-7-10(9)14(11)18-8/h4-8,11,14H,1-3H3/t8-,11+,14-/m0/s1 |
| InChIKey | VICDYVFJMQPAHD-UPLXVJCVSA-N |
| XLogP | 2.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|