C11H13N3O2 — CID 145163432
3-amino-4-[amino(methyl)amino]-3,4-dihydronaphthalene-1,2-dione (PubChem CID 145163432) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-amino-4-[amino(methyl)amino]-3,4-dihydronaphthalene-1,2-dione.
| Compound Name | 3-amino-4-[amino(methyl)amino]-3,4-dihydronaphthalene-1,2-dione |
|---|---|
| PubChem CID | 145163432 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-amino-4-[amino(methyl)amino]-3,4-dihydronaphthalene-1,2-dione |
| SMILES | CN(N)C1c2ccccc2C(=O)C(=O)C1N |
| InChI | InChI=1S/C11H13N3O2/c1-14(13)9-6-4-2-3-5-7(6)10(15)11(16)8(9)12/h2-5,8-9H,12-13H2,1H3 |
| InChIKey | WUXDUYGRPXKRAF-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|