C32H24O2 — CID 11797380
(2Z,3S)-3-(2-methylphenyl)-2-[(1S)-1-(2-methylphenyl)-3-oxo-1H-inden-2-ylidene]-3H-inden-1-one (PubChem CID 11797380) has the molecular formula C32H24O2 and a molecular weight of 440.54 g/mol. Its IUPAC name is (2Z,3S)-3-(2-methylphenyl)-2-[(1S)-1-(2-methylphenyl)-3-oxo-1H-inden-2-ylidene]-3H-inden-1-one.
| Compound Name | (2Z,3S)-3-(2-methylphenyl)-2-[(1S)-1-(2-methylphenyl)-3-oxo-1H-inden-2-ylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 11797380 |
| Molecular Formula | C32H24O2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (2Z,3S)-3-(2-methylphenyl)-2-[(1S)-1-(2-methylphenyl)-3-oxo-1H-inden-2-ylidene]-3H-inden-1-one |
| SMILES | Cc1ccccc1[C@@H]1/C(=C2/C(=O)c3ccccc3[C@@H]2c2ccccc2C)C(=O)c2ccccc21 |
| InChI | InChI=1S/C32H24O2/c1-19-11-3-5-13-21(19)27-23-15-7-9-17-25(23)31(33)29(27)30-28(22-14-6-4-12-20(22)2)24-16-8-10-18-26(24)32(30)34/h3-18,27-28H,1-2H3/b30-29-/t27-,28-/m0/s1 |
| InChIKey | GOVNOSAXAVNGPO-GRUWNNGQSA-N |
| XLogP | 6.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|