C22H16O2 — CID 102426755
4,5-dimethylpentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),4,9,11,13,15,17,19-octaene-3,6-dione (PubChem CID 102426755) has the molecular formula C22H16O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4,5-dimethylpentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),4,9,11,13,15,17,19-octaene-3,6-dione.
| Compound Name | 4,5-dimethylpentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),4,9,11,13,15,17,19-octaene-3,6-dione |
|---|---|
| PubChem CID | 102426755 |
| Molecular Formula | C22H16O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 4,5-dimethylpentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),4,9,11,13,15,17,19-octaene-3,6-dione |
| SMILES | CC1=C(C)C(=O)C2=C(C1=O)C1c3ccccc3C2c2ccccc21 |
| InChI | InChI=1S/C22H16O2/c1-11-12(2)22(24)20-18-15-9-5-3-7-13(15)17(19(20)21(11)23)14-8-4-6-10-16(14)18/h3-10,17-18H,1-2H3 |
| InChIKey | JFXGJXKWHCWAFA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|