C19H22O — CID 102142065
5-cyclohexylidene-2,3-dimethyl-4-phenylcyclopent-2-en-1-one (PubChem CID 102142065) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 5-cyclohexylidene-2,3-dimethyl-4-phenylcyclopent-2-en-1-one.
| Compound Name | 5-cyclohexylidene-2,3-dimethyl-4-phenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 102142065 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 5-cyclohexylidene-2,3-dimethyl-4-phenylcyclopent-2-en-1-one |
| SMILES | CC1=C(C)C(c2ccccc2)C(=C2CCCCC2)C1=O |
| InChI | InChI=1S/C19H22O/c1-13-14(2)19(20)18(16-11-7-4-8-12-16)17(13)15-9-5-3-6-10-15/h3,5-6,9-10,17H,4,7-8,11-12H2,1-2H3 |
| InChIKey | HNFOJPRVYABYCY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|