C11H10N2O3 — CID 817582
(5R)-1-methyl-5-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 817582) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is (5R)-1-methyl-5-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5R)-1-methyl-5-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 817582 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | (5R)-1-methyl-5-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)NC(=O)[C@@H](c2ccccc2)C1=O |
| InChI | InChI=1S/C11H10N2O3/c1-13-10(15)8(9(14)12-11(13)16)7-5-3-2-4-6-7/h2-6,8H,1H3,(H,12,14,16)/t8-/m1/s1 |
| InChIKey | YGVQNHPIDLCYTP-MRVPVSSYSA-N |
| XLogP | 0.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|