C25H29NO2S — CID 135053897
(1S,5S,7R)-6-cyclohexylidene-3-(4-methylphenyl)sulfonyl-7-phenyl-3-azabicyclo[3.2.0]heptane (PubChem CID 135053897) has the molecular formula C25H29NO2S and a molecular weight of 407.58 g/mol. Its IUPAC name is (1S,5S,7R)-6-cyclohexylidene-3-(4-methylphenyl)sulfonyl-7-phenyl-3-azabicyclo[3.2.0]heptane.
| Compound Name | (1S,5S,7R)-6-cyclohexylidene-3-(4-methylphenyl)sulfonyl-7-phenyl-3-azabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 135053897 |
| Molecular Formula | C25H29NO2S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (1S,5S,7R)-6-cyclohexylidene-3-(4-methylphenyl)sulfonyl-7-phenyl-3-azabicyclo[3.2.0]heptane |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3[C@H](C2)C(=C2CCCCC2)[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C25H29NO2S/c1-18-12-14-21(15-13-18)29(27,28)26-16-22-23(17-26)25(20-10-6-3-7-11-20)24(22)19-8-4-2-5-9-19/h2,4-5,8-9,12-15,22-24H,3,6-7,10-11,16-17H2,1H3/t22-,23+,24+/m1/s1 |
| InChIKey | BAGWQVFQGZZXEF-SGNDLWITSA-N |
| XLogP | 5.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|