C34H28O2 — CID 91563450
(3R)-3-(3,5-dimethylphenyl)-2-[(1S)-1-(3,5-dimethylphenyl)-3-oxo-1H-inden-2-ylidene]-3H-inden-1-one (PubChem CID 91563450) has the molecular formula C34H28O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is (3R)-3-(3,5-dimethylphenyl)-2-[(1S)-1-(3,5-dimethylphenyl)-3-oxo-1H-inden-2-ylidene]-3H-inden-1-one.
| Compound Name | (3R)-3-(3,5-dimethylphenyl)-2-[(1S)-1-(3,5-dimethylphenyl)-3-oxo-1H-inden-2-ylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 91563450 |
| Molecular Formula | C34H28O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | (3R)-3-(3,5-dimethylphenyl)-2-[(1S)-1-(3,5-dimethylphenyl)-3-oxo-1H-inden-2-ylidene]-3H-inden-1-one |
| SMILES | Cc1cc(C)cc([C@H]2C(=C3C(=O)c4ccccc4[C@@H]3c3cc(C)cc(C)c3)C(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C34H28O2/c1-19-13-20(2)16-23(15-19)29-25-9-5-7-11-27(25)33(35)31(29)32-30(24-17-21(3)14-22(4)18-24)26-10-6-8-12-28(26)34(32)36/h5-18,29-30H,1-4H3/t29-,30+ |
| InChIKey | ZRLIVCKAHZJQIS-RNPORBBMSA-N |
| XLogP | 7.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|