C12H12N2O2 — CID 159649198
bicyclo[4.2.0]octa-1,3,5-trien-7-amine;pyrrole-2,5-dione (PubChem CID 159649198) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is bicyclo[4.2.0]octa-1,3,5-trien-7-amine;pyrrole-2,5-dione.
| Compound Name | bicyclo[4.2.0]octa-1,3,5-trien-7-amine;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 159649198 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | bicyclo[4.2.0]octa-1,3,5-trien-7-amine;pyrrole-2,5-dione |
| SMILES | NC1Cc2ccccc21.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C8H9N.C4H3NO2/c9-8-5-6-3-1-2-4-7(6)8;6-3-1-2-4(7)5-3/h1-4,8H,5,9H2;1-2H,(H,5,6,7) |
| InChIKey | MRIROVHBUGHIQM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|