C16H14O2 — CID 21322030
2-methoxy-3-phenyl-2,3-dihydroinden-1-one (PubChem CID 21322030) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-methoxy-3-phenyl-2,3-dihydroinden-1-one.
| Compound Name | 2-methoxy-3-phenyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 21322030 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-methoxy-3-phenyl-2,3-dihydroinden-1-one |
| SMILES | COC1C(=O)c2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C16H14O2/c1-18-16-14(11-7-3-2-4-8-11)12-9-5-6-10-13(12)15(16)17/h2-10,14,16H,1H3 |
| InChIKey | DASSQFMVFDONKW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |