C22H16ClNO — CID 170912300
2-[(4-chlorophenyl)iminomethyl]-3-phenyl-2,3-dihydroinden-1-one (PubChem CID 170912300) has the molecular formula C22H16ClNO and a molecular weight of 345.83 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)iminomethyl]-3-phenyl-2,3-dihydroinden-1-one.
| Compound Name | 2-[(4-chlorophenyl)iminomethyl]-3-phenyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 170912300 |
| Molecular Formula | C22H16ClNO |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-[(4-chlorophenyl)iminomethyl]-3-phenyl-2,3-dihydroinden-1-one |
| SMILES | O=C1c2ccccc2C(c2ccccc2)C1/C=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16ClNO/c23-16-10-12-17(13-11-16)24-14-20-21(15-6-2-1-3-7-15)18-8-4-5-9-19(18)22(20)25/h1-14,20-21H/b24-14+ |
| InChIKey | AQCICHKJDAEFKU-ZVHZXABRSA-N |
| XLogP | 5.69 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|