C22H26O4Si — CID 70120423
1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-oxo-1,2-dihydroindene-2-carboxylic acid (PubChem CID 70120423) has the molecular formula C22H26O4Si and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-oxo-1,2-dihydroindene-2-carboxylic acid.
| Compound Name | 1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-oxo-1,2-dihydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 70120423 |
| Molecular Formula | C22H26O4Si |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-oxo-1,2-dihydroindene-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C2c3ccccc3C(=O)C2C(=O)O)cc1 |
| InChI | InChI=1S/C22H26O4Si/c1-22(2,3)27(4,5)26-15-12-10-14(11-13-15)18-16-8-6-7-9-17(16)20(23)19(18)21(24)25/h6-13,18-19H,1-5H3,(H,24,25) |
| InChIKey | ZIIYQNHOCJBOFL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|