C21H32O2Si — CID 167488490
7-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]spiro[3.5]nonan-2-one (PubChem CID 167488490) has the molecular formula C21H32O2Si and a molecular weight of 344.57 g/mol. Its IUPAC name is 7-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]spiro[3.5]nonan-2-one.
| Compound Name | 7-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]spiro[3.5]nonan-2-one |
|---|---|
| PubChem CID | 167488490 |
| Molecular Formula | C21H32O2Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 7-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]spiro[3.5]nonan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C2CCC3(CC2)CC(=O)C3)cc1 |
| InChI | InChI=1S/C21H32O2Si/c1-20(2,3)24(4,5)23-19-8-6-16(7-9-19)17-10-12-21(13-11-17)14-18(22)15-21/h6-9,17H,10-15H2,1-5H3 |
| InChIKey | ZHXKPDDWAFZANV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|