C22H32O3Si — CID 10690701
5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-methoxy-4-prop-1-en-2-ylcyclohex-2-en-1-one (PubChem CID 10690701) has the molecular formula C22H32O3Si and a molecular weight of 372.58 g/mol. Its IUPAC name is 5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-methoxy-4-prop-1-en-2-ylcyclohex-2-en-1-one.
| Compound Name | 5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-methoxy-4-prop-1-en-2-ylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 10690701 |
| Molecular Formula | C22H32O3Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-methoxy-4-prop-1-en-2-ylcyclohex-2-en-1-one |
| SMILES | C=C(C)C1(OC)C=CC(=O)CC1c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H32O3Si/c1-16(2)22(24-6)14-13-18(23)15-20(22)17-9-11-19(12-10-17)25-26(7,8)21(3,4)5/h9-14,20H,1,15H2,2-8H3 |
| InChIKey | INESUVDFZKRKNM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|