C19H28O3Si — CID 11221261
(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(4-methoxyphenyl)cyclohex-2-en-1-one (PubChem CID 11221261) has the molecular formula C19H28O3Si and a molecular weight of 332.52 g/mol. Its IUPAC name is (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(4-methoxyphenyl)cyclohex-2-en-1-one.
| Compound Name | (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(4-methoxyphenyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11221261 |
| Molecular Formula | C19H28O3Si |
| Molecular Weight | 332.52 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(4-methoxyphenyl)cyclohex-2-en-1-one |
| SMILES | COc1ccc([C@@H]2CC(=O)C=C[C@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H28O3Si/c1-19(2,3)23(5,6)22-18-12-9-15(20)13-17(18)14-7-10-16(21-4)11-8-14/h7-12,17-18H,13H2,1-6H3/t17-,18+/m0/s1 |
| InChIKey | SCEBUQNXVBUFQY-ZWKOTPCHSA-N |
| XLogP | 4.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|