C20H31NO5Si — CID 101107113
[(2R,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4-methoxyphenyl)-3,6-dihydro-2H-pyran-3-yl] carbamate (PubChem CID 101107113) has the molecular formula C20H31NO5Si and a molecular weight of 393.56 g/mol. Its IUPAC name is [(2R,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4-methoxyphenyl)-3,6-dihydro-2H-pyran-3-yl] carbamate.
| Compound Name | [(2R,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4-methoxyphenyl)-3,6-dihydro-2H-pyran-3-yl] carbamate |
|---|---|
| PubChem CID | 101107113 |
| Molecular Formula | C20H31NO5Si |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | [(2R,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4-methoxyphenyl)-3,6-dihydro-2H-pyran-3-yl] carbamate |
| SMILES | COc1ccc([C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)C=C[C@H]2OC(N)=O)cc1 |
| InChI | InChI=1S/C20H31NO5Si/c1-20(2,3)27(5,6)24-13-16-11-12-17(26-19(21)22)18(25-16)14-7-9-15(23-4)10-8-14/h7-12,16-18H,13H2,1-6H3,(H2,21,22)/t16-,17+,18+/m0/s1 |
| InChIKey | AIDXGQWEEJEGRU-RCCFBDPRSA-N |
| XLogP | 4.18 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|