C40H64O8Si2 — CID 71579848
bis(2-propan-2-yloxyethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate (PubChem CID 71579848) has the molecular formula C40H64O8Si2 and a molecular weight of 729.12 g/mol. Its IUPAC name is bis(2-propan-2-yloxyethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate.
| Compound Name | bis(2-propan-2-yloxyethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71579848 |
| Molecular Formula | C40H64O8Si2 |
| Molecular Weight | 729.12 g/mol |
| Exact Mass | 728.41 |
| IUPAC Name | bis(2-propan-2-yloxyethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate |
| SMILES | CC(C)OCCOC(=O)C1C(c2ccc(O[Si](C)(C)C(C)(C)C)cc2)C(C(=O)OCCOC(C)C)C1c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C40H64O8Si2/c1-27(2)43-23-25-45-37(41)35-33(29-15-19-31(20-16-29)47-49(11,12)39(5,6)7)36(38(42)46-26-24-44-28(3)4)34(35)30-17-21-32(22-18-30)48-50(13,14)40(8,9)10/h15-22,27-28,33-36H,23-26H2,1-14H3 |
| InChIKey | XUUBTNZPOHIBSK-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.12 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|