C42H64O6Si2 — CID 71580464
bis[(E)-hex-2-enyl] 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate (PubChem CID 71580464) has the molecular formula C42H64O6Si2 and a molecular weight of 721.14 g/mol. Its IUPAC name is bis[(E)-hex-2-enyl] 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate.
| Compound Name | bis[(E)-hex-2-enyl] 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71580464 |
| Molecular Formula | C42H64O6Si2 |
| Molecular Weight | 721.14 g/mol |
| Exact Mass | 720.42 |
| IUPAC Name | bis[(E)-hex-2-enyl] 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate |
| SMILES | CCC/C=C/COC(=O)C1C(c2ccc(O[Si](C)(C)C(C)(C)C)cc2)C(C(=O)OC/C=C/CCC)C1c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C42H64O6Si2/c1-13-15-17-19-29-45-39(43)37-35(31-21-25-33(26-22-31)47-49(9,10)41(3,4)5)38(40(44)46-30-20-18-16-14-2)36(37)32-23-27-34(28-24-32)48-50(11,12)42(6,7)8/h17-28,35-38H,13-16,29-30H2,1-12H3/b19-17+,20-18+ |
| InChIKey | RFOGIXQESHQEEV-XPWSMXQVSA-N |
| XLogP | 11.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.14 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|