C34H46F6O6Si2 — CID 71580250
bis(2,2,2-trifluoroethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate (PubChem CID 71580250) has the molecular formula C34H46F6O6Si2 and a molecular weight of 720.90 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate.
| Compound Name | bis(2,2,2-trifluoroethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71580250 |
| Molecular Formula | C34H46F6O6Si2 |
| Molecular Weight | 720.90 g/mol |
| Exact Mass | 720.27 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C2C(C(=O)OCC(F)(F)F)C(c3ccc(O[Si](C)(C)C(C)(C)C)cc3)C2C(=O)OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C34H46F6O6Si2/c1-31(2,3)47(7,8)45-23-15-11-21(12-16-23)25-27(29(41)43-19-33(35,36)37)26(28(25)30(42)44-20-34(38,39)40)22-13-17-24(18-14-22)46-48(9,10)32(4,5)6/h11-18,25-28H,19-20H2,1-10H3 |
| InChIKey | AGZIGGCDTBLWPF-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.90 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|