C14H22F3NOSi — CID 163375991
4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)aniline (PubChem CID 163375991) has the molecular formula C14H22F3NOSi and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 163375991 |
| Molecular Formula | C14H22F3NOSi |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)aniline |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(N)c(CC(F)(F)F)c1 |
| InChI | InChI=1S/C14H22F3NOSi/c1-13(2,3)20(4,5)19-11-6-7-12(18)10(8-11)9-14(15,16)17/h6-8H,9,18H2,1-5H3 |
| InChIKey | YCCOSKCZECOYIE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|