C44H68O6Si2 — CID 71579657
bis(cyclohexylmethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate (PubChem CID 71579657) has the molecular formula C44H68O6Si2 and a molecular weight of 749.19 g/mol. Its IUPAC name is bis(cyclohexylmethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate.
| Compound Name | bis(cyclohexylmethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71579657 |
| Molecular Formula | C44H68O6Si2 |
| Molecular Weight | 749.19 g/mol |
| Exact Mass | 748.46 |
| IUPAC Name | bis(cyclohexylmethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C2C(C(=O)OCC3CCCCC3)C(c3ccc(O[Si](C)(C)C(C)(C)C)cc3)C2C(=O)OCC2CCCCC2)cc1 |
| InChI | InChI=1S/C44H68O6Si2/c1-43(2,3)51(7,8)49-35-25-21-33(22-26-35)37-39(41(45)47-29-31-17-13-11-14-18-31)38(40(37)42(46)48-30-32-19-15-12-16-20-32)34-23-27-36(28-24-34)50-52(9,10)44(4,5)6/h21-28,31-32,37-40H,11-20,29-30H2,1-10H3 |
| InChIKey | LTGRUANIENHIFO-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.19 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|