About bis[(4-tert-butylcyclohexyl)methyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate
bis[(4-tert-butylcyclohexyl)methyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 139388049) has the molecular formula C31H52O4
and a molecular weight of 488.75 g/mol. Its IUPAC name is bis[(4-tert-butylcyclohexyl)methyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate.
Molecular Properties
| Compound Name | bis[(4-tert-butylcyclohexyl)methyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate |
| PubChem CID | 139388049 |
| Molecular Formula | C31H52O4 |
| Molecular Weight | 488.75 g/mol |
| Exact Mass | 488.39 |
| IUPAC Name | bis[(4-tert-butylcyclohexyl)methyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CC(C)(C)C1CCC(COC(=O)C2C3CCC(C3)C2C(=O)OCC2CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C31H52O4/c1-30(2,3)24-13-7-20(8-14-24)18-34-28(32)26-22-11-12-23(17-22)27(26)29(33)35-19-21-9-15-25(16-10-21)31(4,5)6/h20-27H,7-19H2,1-6H3 |
| InChIKey | FFEFEORZBDFALA-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.75 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis[(4-tert-butylcyclohexyl)methyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(4-tert-butylcyclohexyl)methyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate?
The IUPAC name of bis[(4-tert-butylcyclohexyl)methyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate (CID 139388049) is bis[(4-tert-butylcyclohexyl)methyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate.
What is the SMILES notation for bis[(4-tert-butylcyclohexyl)methyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate?
The canonical SMILES for bis[(4-tert-butylcyclohexyl)methyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate is CC(C)(C)C1CCC(COC(=O)C2C3CCC(C3)C2C(=O)OCC2CCC(C(C)(C)C)CC2)CC1.
What is the InChIKey of bis[(4-tert-butylcyclohexyl)methyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate?
The InChIKey is FFEFEORZBDFALA-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H52O4/c1-30(2,3)24-13-7-20(8-14-24)18-34-28(32)26-22-11-12-23(17-22)27(26)29(33)35-19-21-9-15-25(16-10-21)31(4,5)6/h20-27H,7-19H2,1-6H3.
What are the key properties of bis[(4-tert-butylcyclohexyl)methyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate?
bis[(4-tert-butylcyclohexyl)methyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate has a molecular weight of 488.75 g/mol, XLogP of 7.44, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(4-tert-butylcyclohexyl)methyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate is sourced from PubChem (CID 139388049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).