C19H30O4 — CID 129175515
ditert-butyl tricyclo[4.2.1.02,5]nonane-3,4-dicarboxylate (PubChem CID 129175515) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is ditert-butyl tricyclo[4.2.1.02,5]nonane-3,4-dicarboxylate.
| Compound Name | ditert-butyl tricyclo[4.2.1.02,5]nonane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 129175515 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | ditert-butyl tricyclo[4.2.1.02,5]nonane-3,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1C(C(=O)OC(C)(C)C)C2C3CCC(C3)C12 |
| InChI | InChI=1S/C19H30O4/c1-18(2,3)22-16(20)14-12-10-7-8-11(9-10)13(12)15(14)17(21)23-19(4,5)6/h10-15H,7-9H2,1-6H3 |
| InChIKey | OAWVKXSCLOFPRR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |