C15H25NO2 — CID 114095991
tert-butyl 2-(3-tricyclo[3.2.1.02,4]octanylamino)propanoate (PubChem CID 114095991) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is tert-butyl 2-(3-tricyclo[3.2.1.02,4]octanylamino)propanoate.
| Compound Name | tert-butyl 2-(3-tricyclo[3.2.1.02,4]octanylamino)propanoate |
|---|---|
| PubChem CID | 114095991 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | tert-butyl 2-(3-tricyclo[3.2.1.02,4]octanylamino)propanoate |
| SMILES | CC(NC1C2C3CCC(C3)C12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO2/c1-8(14(17)18-15(2,3)4)16-13-11-9-5-6-10(7-9)12(11)13/h8-13,16H,5-7H2,1-4H3 |
| InChIKey | ONMJAJORHPTPLM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |