C40H60O8Si2 — CID 71579475
bis(oxolan-2-ylmethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate (PubChem CID 71579475) has the molecular formula C40H60O8Si2 and a molecular weight of 725.08 g/mol. Its IUPAC name is bis(oxolan-2-ylmethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate.
| Compound Name | bis(oxolan-2-ylmethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71579475 |
| Molecular Formula | C40H60O8Si2 |
| Molecular Weight | 725.08 g/mol |
| Exact Mass | 724.38 |
| IUPAC Name | bis(oxolan-2-ylmethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C2C(C(=O)OCC3CCCO3)C(c3ccc(O[Si](C)(C)C(C)(C)C)cc3)C2C(=O)OCC2CCCO2)cc1 |
| InChI | InChI=1S/C40H60O8Si2/c1-39(2,3)49(7,8)47-29-19-15-27(16-20-29)33-35(37(41)45-25-31-13-11-23-43-31)34(36(33)38(42)46-26-32-14-12-24-44-32)28-17-21-30(22-18-28)48-50(9,10)40(4,5)6/h15-22,31-36H,11-14,23-26H2,1-10H3 |
| InChIKey | QPHPKNDKXBJTCM-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.08 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|