C25H46O2Si2 — CID 18922427
tert-butyl-[2-[cyclohexylmethoxy(dimethyl)silyl]-2-methyl-1-phenylpropoxy]-dimethylsilane (PubChem CID 18922427) has the molecular formula C25H46O2Si2 and a molecular weight of 434.81 g/mol. Its IUPAC name is tert-butyl-[2-[cyclohexylmethoxy(dimethyl)silyl]-2-methyl-1-phenylpropoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[cyclohexylmethoxy(dimethyl)silyl]-2-methyl-1-phenylpropoxy]-dimethylsilane |
|---|---|
| PubChem CID | 18922427 |
| Molecular Formula | C25H46O2Si2 |
| Molecular Weight | 434.81 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | tert-butyl-[2-[cyclohexylmethoxy(dimethyl)silyl]-2-methyl-1-phenylpropoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(c1ccccc1)C(C)(C)[Si](C)(C)OCC1CCCCC1 |
| InChI | InChI=1S/C25H46O2Si2/c1-24(2,3)28(6,7)27-23(22-18-14-11-15-19-22)25(4,5)29(8,9)26-20-21-16-12-10-13-17-21/h11,14-15,18-19,21,23H,10,12-13,16-17,20H2,1-9H3 |
| InChIKey | WBYLWFXALUWAHC-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.81 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|