C23H38O2Si — CID 10643161
(1S)-3-[(R)-[tert-butyl(dimethyl)silyl]oxy-cyclohexylmethyl]-1-phenylbut-3-en-1-ol (PubChem CID 10643161) has the molecular formula C23H38O2Si and a molecular weight of 374.64 g/mol. Its IUPAC name is (1S)-3-[(R)-[tert-butyl(dimethyl)silyl]oxy-cyclohexylmethyl]-1-phenylbut-3-en-1-ol.
| Compound Name | (1S)-3-[(R)-[tert-butyl(dimethyl)silyl]oxy-cyclohexylmethyl]-1-phenylbut-3-en-1-ol |
|---|---|
| PubChem CID | 10643161 |
| Molecular Formula | C23H38O2Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | (1S)-3-[(R)-[tert-butyl(dimethyl)silyl]oxy-cyclohexylmethyl]-1-phenylbut-3-en-1-ol |
| SMILES | C=C(C[C@H](O)c1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C23H38O2Si/c1-18(17-21(24)19-13-9-7-10-14-19)22(20-15-11-8-12-16-20)25-26(5,6)23(2,3)4/h7,9-10,13-14,20-22,24H,1,8,11-12,15-17H2,2-6H3/t21-,22-/m0/s1 |
| InChIKey | VOQKDRLFBZLAIP-VXKWHMMOSA-N |
| XLogP | 6.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|