C21H36O2Si — CID 10521719
(1R,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-3-methylidene-1-phenylhexan-1-ol (PubChem CID 10521719) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is (1R,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-3-methylidene-1-phenylhexan-1-ol.
| Compound Name | (1R,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-3-methylidene-1-phenylhexan-1-ol |
|---|---|
| PubChem CID | 10521719 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (1R,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-3-methylidene-1-phenylhexan-1-ol |
| SMILES | C=C(C[C@@H](O)c1ccccc1)[C@@H](CO[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C21H36O2Si/c1-16(2)19(15-23-24(7,8)21(4,5)6)17(3)14-20(22)18-12-10-9-11-13-18/h9-13,16,19-20,22H,3,14-15H2,1-2,4-8H3/t19-,20+/m0/s1 |
| InChIKey | RHVSUPZZNHAHON-VQTJNVASSA-N |
| XLogP | 5.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|