C27H35NO2Si — CID 134925763
N-benzhydryl-N-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]hydroxylamine (PubChem CID 134925763) has the molecular formula C27H35NO2Si and a molecular weight of 433.67 g/mol. Its IUPAC name is N-benzhydryl-N-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]hydroxylamine.
| Compound Name | N-benzhydryl-N-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]hydroxylamine |
|---|---|
| PubChem CID | 134925763 |
| Molecular Formula | C27H35NO2Si |
| Molecular Weight | 433.67 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | N-benzhydryl-N-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]hydroxylamine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](c1ccccc1)N(O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H35NO2Si/c1-27(2,3)31(4,5)30-21-25(22-15-9-6-10-16-22)28(29)26(23-17-11-7-12-18-23)24-19-13-8-14-20-24/h6-20,25-26,29H,21H2,1-5H3/t25-/m1/s1 |
| InChIKey | VLYPALLYQYEDQB-RUZDIDTESA-N |
| XLogP | 7.23 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.67 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|