C32H47NO7Si — CID 10371107
[(2R,3S,4R,5S)-3,4-diacetyloxy-5-[benzhydryl(methyl)amino]-6-[tert-butyl(dimethyl)silyl]oxyhexan-2-yl] acetate (PubChem CID 10371107) has the molecular formula C32H47NO7Si and a molecular weight of 585.81 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,4-diacetyloxy-5-[benzhydryl(methyl)amino]-6-[tert-butyl(dimethyl)silyl]oxyhexan-2-yl] acetate.
| Compound Name | [(2R,3S,4R,5S)-3,4-diacetyloxy-5-[benzhydryl(methyl)amino]-6-[tert-butyl(dimethyl)silyl]oxyhexan-2-yl] acetate |
|---|---|
| PubChem CID | 10371107 |
| Molecular Formula | C32H47NO7Si |
| Molecular Weight | 585.81 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | [(2R,3S,4R,5S)-3,4-diacetyloxy-5-[benzhydryl(methyl)amino]-6-[tert-butyl(dimethyl)silyl]oxyhexan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]([C@H](OC(C)=O)[C@H](CO[Si](C)(C)C(C)(C)C)N(C)C(c1ccccc1)c1ccccc1)[C@@H](C)OC(C)=O |
| InChI | InChI=1S/C32H47NO7Si/c1-22(38-23(2)34)30(39-24(3)35)31(40-25(4)36)28(21-37-41(9,10)32(5,6)7)33(8)29(26-17-13-11-14-18-26)27-19-15-12-16-20-27/h11-20,22,28-31H,21H2,1-10H3/t22-,28+,30+,31-/m1/s1 |
| InChIKey | OCSWWCZAFQOGEC-NKSLUFASSA-N |
| XLogP | 5.91 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.81 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|