C18H28O3Si — CID 99772458
methyl (3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3-phenylbutanoate (PubChem CID 99772458) has the molecular formula C18H28O3Si and a molecular weight of 320.51 g/mol. Its IUPAC name is methyl (3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3-phenylbutanoate.
| Compound Name | methyl (3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3-phenylbutanoate |
|---|---|
| PubChem CID | 99772458 |
| Molecular Formula | C18H28O3Si |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | methyl (3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3-phenylbutanoate |
| SMILES | C=C(C(=O)OC)[C@H](CO[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H28O3Si/c1-14(17(19)20-5)16(15-11-9-8-10-12-15)13-21-22(6,7)18(2,3)4/h8-12,16H,1,13H2,2-7H3/t16-/m0/s1 |
| InChIKey | TYRBHCKOOYRDSX-INIZCTEOSA-N |
| XLogP | 4.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|