C16H29O4PSi — CID 15108856
tert-butyl-(2-dimethoxyphosphoryl-2-phenylethoxy)-dimethylsilane (PubChem CID 15108856) has the molecular formula C16H29O4PSi and a molecular weight of 344.46 g/mol. Its IUPAC name is tert-butyl-(2-dimethoxyphosphoryl-2-phenylethoxy)-dimethylsilane.
| Compound Name | tert-butyl-(2-dimethoxyphosphoryl-2-phenylethoxy)-dimethylsilane |
|---|---|
| PubChem CID | 15108856 |
| Molecular Formula | C16H29O4PSi |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | tert-butyl-(2-dimethoxyphosphoryl-2-phenylethoxy)-dimethylsilane |
| SMILES | COP(=O)(OC)C(CO[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H29O4PSi/c1-16(2,3)22(6,7)20-13-15(21(17,18-4)19-5)14-11-9-8-10-12-14/h8-12,15H,13H2,1-7H3 |
| InChIKey | HIRNEQMMKYLMAO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|