C17H31O4PSi — CID 15108858
tert-butyl-(3-dimethoxyphosphoryl-3-phenylpropoxy)-dimethylsilane (PubChem CID 15108858) has the molecular formula C17H31O4PSi and a molecular weight of 358.49 g/mol. Its IUPAC name is tert-butyl-(3-dimethoxyphosphoryl-3-phenylpropoxy)-dimethylsilane.
| Compound Name | tert-butyl-(3-dimethoxyphosphoryl-3-phenylpropoxy)-dimethylsilane |
|---|---|
| PubChem CID | 15108858 |
| Molecular Formula | C17H31O4PSi |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | tert-butyl-(3-dimethoxyphosphoryl-3-phenylpropoxy)-dimethylsilane |
| SMILES | COP(=O)(OC)C(CCO[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H31O4PSi/c1-17(2,3)23(6,7)21-14-13-16(22(18,19-4)20-5)15-11-9-8-10-12-15/h8-12,16H,13-14H2,1-7H3 |
| InChIKey | WLENXQVXPONQAE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|