C22H31O6PSi — CID 71561246
4-[tert-butyl(diphenyl)silyl]oxy-2-dimethoxyphosphorylbutanoic acid (PubChem CID 71561246) has the molecular formula C22H31O6PSi and a molecular weight of 450.54 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-2-dimethoxyphosphorylbutanoic acid.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-2-dimethoxyphosphorylbutanoic acid |
|---|---|
| PubChem CID | 71561246 |
| Molecular Formula | C22H31O6PSi |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-2-dimethoxyphosphorylbutanoic acid |
| SMILES | COP(=O)(OC)C(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C22H31O6PSi/c1-22(2,3)30(18-12-8-6-9-13-18,19-14-10-7-11-15-19)28-17-16-20(21(23)24)29(25,26-4)27-5/h6-15,20H,16-17H2,1-5H3,(H,23,24) |
| InChIKey | GNIHONVDJKWJCK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|