C28H42NO7PSi — CID 101226017
tert-butyl N-[(3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-dimethoxyphosphoryl-2-oxopentan-3-yl]carbamate (PubChem CID 101226017) has the molecular formula C28H42NO7PSi and a molecular weight of 563.70 g/mol. Its IUPAC name is tert-butyl N-[(3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-dimethoxyphosphoryl-2-oxopentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-dimethoxyphosphoryl-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 101226017 |
| Molecular Formula | C28H42NO7PSi |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | tert-butyl N-[(3S)-5-[tert-butyl(diphenyl)silyl]oxy-1-dimethoxyphosphoryl-2-oxopentan-3-yl]carbamate |
| SMILES | COP(=O)(CC(=O)[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C28H42NO7PSi/c1-27(2,3)36-26(31)29-24(25(30)21-37(32,33-7)34-8)19-20-35-38(28(4,5)6,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-18,24H,19-21H2,1-8H3,(H,29,31)/t24-/m0/s1 |
| InChIKey | PIXWJMGGNWKMPF-DEOSSOPVSA-N |
| XLogP | 4.90 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|