C16H25N2O6P — CID 87114293
tert-butyl N-(4-dimethoxyphosphoryl-3-oxo-1-pyridin-4-ylbutan-2-yl)carbamate (PubChem CID 87114293) has the molecular formula C16H25N2O6P and a molecular weight of 372.36 g/mol. Its IUPAC name is tert-butyl N-(4-dimethoxyphosphoryl-3-oxo-1-pyridin-4-ylbutan-2-yl)carbamate.
| Compound Name | tert-butyl N-(4-dimethoxyphosphoryl-3-oxo-1-pyridin-4-ylbutan-2-yl)carbamate |
|---|---|
| PubChem CID | 87114293 |
| Molecular Formula | C16H25N2O6P |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | tert-butyl N-(4-dimethoxyphosphoryl-3-oxo-1-pyridin-4-ylbutan-2-yl)carbamate |
| SMILES | COP(=O)(CC(=O)C(Cc1ccncc1)NC(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C16H25N2O6P/c1-16(2,3)24-15(20)18-13(10-12-6-8-17-9-7-12)14(19)11-25(21,22-4)23-5/h6-9,13H,10-11H2,1-5H3,(H,18,20) |
| InChIKey | RTTSAEAXIDUYCE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|