C16H28N3O7P — CID 87114148
tert-butyl N-[4-dimethoxyphosphoryl-1-(5-methoxy-1-methylpyrazol-3-yl)-3-oxobutan-2-yl]carbamate (PubChem CID 87114148) has the molecular formula C16H28N3O7P and a molecular weight of 405.39 g/mol. Its IUPAC name is tert-butyl N-[4-dimethoxyphosphoryl-1-(5-methoxy-1-methylpyrazol-3-yl)-3-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-dimethoxyphosphoryl-1-(5-methoxy-1-methylpyrazol-3-yl)-3-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 87114148 |
| Molecular Formula | C16H28N3O7P |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | tert-butyl N-[4-dimethoxyphosphoryl-1-(5-methoxy-1-methylpyrazol-3-yl)-3-oxobutan-2-yl]carbamate |
| SMILES | COc1cc(CC(NC(=O)OC(C)(C)C)C(=O)CP(=O)(OC)OC)nn1C |
| InChI | InChI=1S/C16H28N3O7P/c1-16(2,3)26-15(21)17-12(13(20)10-27(22,24-6)25-7)8-11-9-14(23-5)19(4)18-11/h9,12H,8,10H2,1-7H3,(H,17,21) |
| InChIKey | QRGLBGHJDLIQJG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|