C16H24NO7P — CID 18664120
(2S)-3-(4-dimethoxyphosphorylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 18664120) has the molecular formula C16H24NO7P and a molecular weight of 373.34 g/mol. Its IUPAC name is (2S)-3-(4-dimethoxyphosphorylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-(4-dimethoxyphosphorylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 18664120 |
| Molecular Formula | C16H24NO7P |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (2S)-3-(4-dimethoxyphosphorylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | COP(=O)(OC)c1ccc(C[C@H](NC(=O)OC(C)(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C16H24NO7P/c1-16(2,3)24-15(20)17-13(14(18)19)10-11-6-8-12(9-7-11)25(21,22-4)23-5/h6-9,13H,10H2,1-5H3,(H,17,20)(H,18,19)/t13-/m0/s1 |
| InChIKey | ASFXXRNMGJITBA-ZDUSSCGKSA-N |
| XLogP | 2.32 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|