C17H26NO6P — CID 161451328
butyl N-[(2S)-4-dimethoxyphosphoryl-3-oxo-1-phenylbutan-2-yl]carbamate (PubChem CID 161451328) has the molecular formula C17H26NO6P and a molecular weight of 371.37 g/mol. Its IUPAC name is butyl N-[(2S)-4-dimethoxyphosphoryl-3-oxo-1-phenylbutan-2-yl]carbamate.
| Compound Name | butyl N-[(2S)-4-dimethoxyphosphoryl-3-oxo-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 161451328 |
| Molecular Formula | C17H26NO6P |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | butyl N-[(2S)-4-dimethoxyphosphoryl-3-oxo-1-phenylbutan-2-yl]carbamate |
| SMILES | CCCCOC(=O)N[C@@H](Cc1ccccc1)C(=O)CP(=O)(OC)OC |
| InChI | InChI=1S/C17H26NO6P/c1-4-5-11-24-17(20)18-15(12-14-9-7-6-8-10-14)16(19)13-25(21,22-2)23-3/h6-10,15H,4-5,11-13H2,1-3H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | WAOKUBZSKCSTHC-HNNXBMFYSA-N |
| XLogP | 3.18 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|