C29H40N2O6 — CID 70075608
butyl N-[(2S,3R,6S)-6-(butoxycarbonylamino)-3-hydroxy-5-oxo-1,7-diphenylheptan-2-yl]carbamate (PubChem CID 70075608) has the molecular formula C29H40N2O6 and a molecular weight of 512.65 g/mol. Its IUPAC name is butyl N-[(2S,3R,6S)-6-(butoxycarbonylamino)-3-hydroxy-5-oxo-1,7-diphenylheptan-2-yl]carbamate.
| Compound Name | butyl N-[(2S,3R,6S)-6-(butoxycarbonylamino)-3-hydroxy-5-oxo-1,7-diphenylheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 70075608 |
| Molecular Formula | C29H40N2O6 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | butyl N-[(2S,3R,6S)-6-(butoxycarbonylamino)-3-hydroxy-5-oxo-1,7-diphenylheptan-2-yl]carbamate |
| SMILES | CCCCOC(=O)N[C@@H](Cc1ccccc1)C(=O)C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OCCCC |
| InChI | InChI=1S/C29H40N2O6/c1-3-5-17-36-28(34)30-24(19-22-13-9-7-10-14-22)26(32)21-27(33)25(20-23-15-11-8-12-16-23)31-29(35)37-18-6-4-2/h7-16,24-26,32H,3-6,17-21H2,1-2H3,(H,30,34)(H,31,35)/t24-,25-,26+/m0/s1 |
| InChIKey | ZLYNFOFIAGBPIF-KKUQBAQOSA-N |
| XLogP | 4.58 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|