C19H30N2O4 — CID 91309503
butyl N-[(2S,3S,4S)-3,4-dihydroxy-1-phenyl-4-[(2S)-pyrrolidin-2-yl]butan-2-yl]carbamate (PubChem CID 91309503) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is butyl N-[(2S,3S,4S)-3,4-dihydroxy-1-phenyl-4-[(2S)-pyrrolidin-2-yl]butan-2-yl]carbamate.
| Compound Name | butyl N-[(2S,3S,4S)-3,4-dihydroxy-1-phenyl-4-[(2S)-pyrrolidin-2-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 91309503 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | butyl N-[(2S,3S,4S)-3,4-dihydroxy-1-phenyl-4-[(2S)-pyrrolidin-2-yl]butan-2-yl]carbamate |
| SMILES | CCCCOC(=O)N[C@@H](Cc1ccccc1)[C@H](O)[C@@H](O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C19H30N2O4/c1-2-3-12-25-19(24)21-16(13-14-8-5-4-6-9-14)18(23)17(22)15-10-7-11-20-15/h4-6,8-9,15-18,20,22-23H,2-3,7,10-13H2,1H3,(H,21,24)/t15-,16-,17-,18-/m0/s1 |
| InChIKey | SKQJQKYKWSTILD-XSLAGTTESA-N |
| XLogP | 1.60 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|