C16H23ClN2O4 — CID 70062434
methyl 2-hydroxy-4-phenyl-3-[[(2S)-pyrrolidine-2-carbonyl]amino]butanoate;hydrochloride (PubChem CID 70062434) has the molecular formula C16H23ClN2O4 and a molecular weight of 342.82 g/mol. Its IUPAC name is methyl 2-hydroxy-4-phenyl-3-[[(2S)-pyrrolidine-2-carbonyl]amino]butanoate;hydrochloride.
| Compound Name | methyl 2-hydroxy-4-phenyl-3-[[(2S)-pyrrolidine-2-carbonyl]amino]butanoate;hydrochloride |
|---|---|
| PubChem CID | 70062434 |
| Molecular Formula | C16H23ClN2O4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | methyl 2-hydroxy-4-phenyl-3-[[(2S)-pyrrolidine-2-carbonyl]amino]butanoate;hydrochloride |
| SMILES | COC(=O)C(O)C(Cc1ccccc1)NC(=O)[C@@H]1CCCN1.Cl |
| InChI | InChI=1S/C16H22N2O4.ClH/c1-22-16(21)14(19)13(10-11-6-3-2-4-7-11)18-15(20)12-8-5-9-17-12;/h2-4,6-7,12-14,17,19H,5,8-10H2,1H3,(H,18,20);1H/t12-,13?,14?;/m0./s1 |
| InChIKey | PHLLTFOJEBOHTD-NEWLCSRUSA-N |
| XLogP | 0.42 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |