C19H32N2O3 — CID 70243931
butyl N-[(2S,3S)-4-amino-3-hydroxy-6-methyl-1-phenylheptan-2-yl]carbamate (PubChem CID 70243931) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is butyl N-[(2S,3S)-4-amino-3-hydroxy-6-methyl-1-phenylheptan-2-yl]carbamate.
| Compound Name | butyl N-[(2S,3S)-4-amino-3-hydroxy-6-methyl-1-phenylheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 70243931 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | butyl N-[(2S,3S)-4-amino-3-hydroxy-6-methyl-1-phenylheptan-2-yl]carbamate |
| SMILES | CCCCOC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C(N)CC(C)C |
| InChI | InChI=1S/C19H32N2O3/c1-4-5-11-24-19(23)21-17(13-15-9-7-6-8-10-15)18(22)16(20)12-14(2)3/h6-10,14,16-18,22H,4-5,11-13,20H2,1-3H3,(H,21,23)/t16?,17-,18-/m0/s1 |
| InChIKey | MHPXHCQNDYGKHT-FQECFTEESA-N |
| XLogP | 2.86 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|