C14H21NO3 — CID 151882072
butyl N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]carbamate (PubChem CID 151882072) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is butyl N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]carbamate.
| Compound Name | butyl N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 151882072 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | butyl N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCOC(=O)N[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C14H21NO3/c1-2-3-9-18-14(17)15-13(11-16)10-12-7-5-4-6-8-12/h4-8,13,16H,2-3,9-11H2,1H3,(H,15,17)/t13-/m1/s1 |
| InChIKey | SOXYYCOFQLRLLK-CYBMUJFWSA-N |
| XLogP | 2.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|